C15H20O4S3 — CID 134917860
methyl 2-(benzenesulfonyl)-5-(1,3-dioxolan-2-yl)pentanedithioate (PubChem CID 134917860) has the molecular formula C15H20O4S3 and a molecular weight of 360.52 g/mol. Its IUPAC name is methyl 2-(benzenesulfonyl)-5-(1,3-dioxolan-2-yl)pentanedithioate.
| Compound Name | methyl 2-(benzenesulfonyl)-5-(1,3-dioxolan-2-yl)pentanedithioate |
|---|---|
| PubChem CID | 134917860 |
| Molecular Formula | C15H20O4S3 |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | methyl 2-(benzenesulfonyl)-5-(1,3-dioxolan-2-yl)pentanedithioate |
| SMILES | CSC(=S)C(CCCC1OCCO1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H20O4S3/c1-21-15(20)13(8-5-9-14-18-10-11-19-14)22(16,17)12-6-3-2-4-7-12/h2-4,6-7,13-14H,5,8-11H2,1H3 |
| InChIKey | WJGMLTNQJIZQKJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|