C21H31NO2Si — CID 134918130
(4R)-4-benzyl-3-[2-tri(propan-2-yl)silylethynyl]-1,3-oxazolidin-2-one (PubChem CID 134918130) has the molecular formula C21H31NO2Si and a molecular weight of 357.57 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[2-tri(propan-2-yl)silylethynyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[2-tri(propan-2-yl)silylethynyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134918130 |
| Molecular Formula | C21H31NO2Si |
| Molecular Weight | 357.57 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (4R)-4-benzyl-3-[2-tri(propan-2-yl)silylethynyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)[Si](C#CN1C(=O)OC[C@H]1Cc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H31NO2Si/c1-16(2)25(17(3)4,18(5)6)13-12-22-20(15-24-21(22)23)14-19-10-8-7-9-11-19/h7-11,16-18,20H,14-15H2,1-6H3/t20-/m1/s1 |
| InChIKey | GVTGPRDNIVGMEP-HXUWFJFHSA-N |
| XLogP | 5.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|