C28H29NO5 — CID 134918487
methyl (2R,3R)-2-benzamido-2-benzyl-3-(2,4-dimethoxyphenyl)pent-4-enoate (PubChem CID 134918487) has the molecular formula C28H29NO5 and a molecular weight of 459.54 g/mol. Its IUPAC name is methyl (2R,3R)-2-benzamido-2-benzyl-3-(2,4-dimethoxyphenyl)pent-4-enoate.
| Compound Name | methyl (2R,3R)-2-benzamido-2-benzyl-3-(2,4-dimethoxyphenyl)pent-4-enoate |
|---|---|
| PubChem CID | 134918487 |
| Molecular Formula | C28H29NO5 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | methyl (2R,3R)-2-benzamido-2-benzyl-3-(2,4-dimethoxyphenyl)pent-4-enoate |
| SMILES | C=C[C@H](c1ccc(OC)cc1OC)[C@@](Cc1ccccc1)(NC(=O)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C28H29NO5/c1-5-24(23-17-16-22(32-2)18-25(23)33-3)28(27(31)34-4,19-20-12-8-6-9-13-20)29-26(30)21-14-10-7-11-15-21/h5-18,24H,1,19H2,2-4H3,(H,29,30)/t24-,28-/m1/s1 |
| InChIKey | CKDPLCPYTATDOB-UFHPHHKVSA-N |
| XLogP | 4.56 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|