C13H14O6 — CID 134919109
2,3-dimethoxy-5-(3-methoxyprop-2-ynoxymethyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 134919109) has the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. Its IUPAC name is 2,3-dimethoxy-5-(3-methoxyprop-2-ynoxymethyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3-dimethoxy-5-(3-methoxyprop-2-ynoxymethyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 134919109 |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 2,3-dimethoxy-5-(3-methoxyprop-2-ynoxymethyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | COC#CCOCC1=CC(=O)C(OC)=C(OC)C1=O |
| InChI | InChI=1S/C13H14O6/c1-16-5-4-6-19-8-9-7-10(14)12(17-2)13(18-3)11(9)15/h7H,6,8H2,1-3H3 |
| InChIKey | HZCGUSPOCWJQLA-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|