C19H29NOSe — CID 134919507
4-ethyl-2-(4-methylphenyl)-6,6-di(propan-2-yl)-5H-1,3-selenazin-4-ol (PubChem CID 134919507) has the molecular formula C19H29NOSe and a molecular weight of 366.41 g/mol. Its IUPAC name is 4-ethyl-2-(4-methylphenyl)-6,6-di(propan-2-yl)-5H-1,3-selenazin-4-ol.
| Compound Name | 4-ethyl-2-(4-methylphenyl)-6,6-di(propan-2-yl)-5H-1,3-selenazin-4-ol |
|---|---|
| PubChem CID | 134919507 |
| Molecular Formula | C19H29NOSe |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 4-ethyl-2-(4-methylphenyl)-6,6-di(propan-2-yl)-5H-1,3-selenazin-4-ol |
| SMILES | CCC1(O)CC(C(C)C)(C(C)C)[Se]C(c2ccc(C)cc2)=N1 |
| InChI | InChI=1S/C19H29NOSe/c1-7-18(21)12-19(13(2)3,14(4)5)22-17(20-18)16-10-8-15(6)9-11-16/h8-11,13-14,21H,7,12H2,1-6H3 |
| InChIKey | YFYRZYGPLODZIC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|