C29H46Cl2O — CID 134919891
(1S,2S,4R,7S,9R,12R,13S,16R,17R)-5,5-dichloro-2,17-dimethyl-16-[(2R)-6-methylheptan-2-yl]pentacyclo[10.7.0.02,9.04,7.013,17]nonadecan-6-one (PubChem CID 134919891) has the molecular formula C29H46Cl2O and a molecular weight of 481.59 g/mol. Its IUPAC name is (1S,2S,4R,7S,9R,12R,13S,16R,17R)-5,5-dichloro-2,17-dimethyl-16-[(2R)-6-methylheptan-2-yl]pentacyclo[10.7.0.02,9.04,7.013,17]nonadecan-6-one.
| Compound Name | (1S,2S,4R,7S,9R,12R,13S,16R,17R)-5,5-dichloro-2,17-dimethyl-16-[(2R)-6-methylheptan-2-yl]pentacyclo[10.7.0.02,9.04,7.013,17]nonadecan-6-one |
|---|---|
| PubChem CID | 134919891 |
| Molecular Formula | C29H46Cl2O |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | (1S,2S,4R,7S,9R,12R,13S,16R,17R)-5,5-dichloro-2,17-dimethyl-16-[(2R)-6-methylheptan-2-yl]pentacyclo[10.7.0.02,9.04,7.013,17]nonadecan-6-one |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@@H]5C(=O)C(Cl)(Cl)[C@@H]5C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H46Cl2O/c1-17(2)7-6-8-18(3)22-11-12-23-20-10-9-19-15-21-25(29(30,31)26(21)32)16-28(19,5)24(20)13-14-27(22,23)4/h17-25H,6-16H2,1-5H3/t18-,19-,20+,21+,22-,23+,24+,25-,27-,28+/m1/s1 |
| InChIKey | WFWJTZAJBZWNGL-YKPJKDLKSA-N |
| XLogP | 8.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|