C30H48Cl2O — CID 99576090
(1S,2S,4S,7R,9R,12R,13S,16R,17R)-6,6-dichloro-2,7,17-trimethyl-16-[(2S)-6-methylheptan-2-yl]pentacyclo[10.7.0.02,9.04,7.013,17]nonadecan-5-one (PubChem CID 99576090) has the molecular formula C30H48Cl2O and a molecular weight of 495.62 g/mol. Its IUPAC name is (1S,2S,4S,7R,9R,12R,13S,16R,17R)-6,6-dichloro-2,7,17-trimethyl-16-[(2S)-6-methylheptan-2-yl]pentacyclo[10.7.0.02,9.04,7.013,17]nonadecan-5-one.
| Compound Name | (1S,2S,4S,7R,9R,12R,13S,16R,17R)-6,6-dichloro-2,7,17-trimethyl-16-[(2S)-6-methylheptan-2-yl]pentacyclo[10.7.0.02,9.04,7.013,17]nonadecan-5-one |
|---|---|
| PubChem CID | 99576090 |
| Molecular Formula | C30H48Cl2O |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | (1S,2S,4S,7R,9R,12R,13S,16R,17R)-6,6-dichloro-2,7,17-trimethyl-16-[(2S)-6-methylheptan-2-yl]pentacyclo[10.7.0.02,9.04,7.013,17]nonadecan-5-one |
| SMILES | CC(C)CCC[C@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@]5(C)[C@H](C[C@]4(C)[C@H]3CC[C@]12C)C(=O)C5(Cl)Cl |
| InChI | InChI=1S/C30H48Cl2O/c1-18(2)8-7-9-19(3)22-12-13-23-21-11-10-20-16-29(6)25(26(33)30(29,31)32)17-28(20,5)24(21)14-15-27(22,23)4/h18-25H,7-17H2,1-6H3/t19-,20+,21-,22+,23-,24-,25+,27+,28-,29+/m0/s1 |
| InChIKey | DZLHDHZKWZQHFB-VJOYLWRDSA-N |
| XLogP | 9.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|