C18H31N3O — CID 134920312
(4R)-1-cyclohexyl-6-cyclohexylimino-4-ethyl-1,3-diazinan-2-one (PubChem CID 134920312) has the molecular formula C18H31N3O and a molecular weight of 305.47 g/mol. Its IUPAC name is (4R)-1-cyclohexyl-6-cyclohexylimino-4-ethyl-1,3-diazinan-2-one.
| Compound Name | (4R)-1-cyclohexyl-6-cyclohexylimino-4-ethyl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 134920312 |
| Molecular Formula | C18H31N3O |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | (4R)-1-cyclohexyl-6-cyclohexylimino-4-ethyl-1,3-diazinan-2-one |
| SMILES | CC[C@@H]1C/C(=N\C2CCCCC2)N(C2CCCCC2)C(=O)N1 |
| InChI | InChI=1S/C18H31N3O/c1-2-14-13-17(19-15-9-5-3-6-10-15)21(18(22)20-14)16-11-7-4-8-12-16/h14-16H,2-13H2,1H3,(H,20,22)/b19-17+/t14-/m1/s1 |
| InChIKey | LXJYKVQTSVTPTL-UFOSLELVSA-N |
| XLogP | 4.24 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|