C27H44IN4OP — CID 102362855
1,3-dicyclohexyl-4,6-bis(cyclohexylimino)-5-iodo-1,3,5-diazaphosphinan-2-one (PubChem CID 102362855) has the molecular formula C27H44IN4OP and a molecular weight of 598.55 g/mol. Its IUPAC name is 1,3-dicyclohexyl-4,6-bis(cyclohexylimino)-5-iodo-1,3,5-diazaphosphinan-2-one.
| Compound Name | 1,3-dicyclohexyl-4,6-bis(cyclohexylimino)-5-iodo-1,3,5-diazaphosphinan-2-one |
|---|---|
| PubChem CID | 102362855 |
| Molecular Formula | C27H44IN4OP |
| Molecular Weight | 598.55 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | 1,3-dicyclohexyl-4,6-bis(cyclohexylimino)-5-iodo-1,3,5-diazaphosphinan-2-one |
| SMILES | O=c1n(C2CCCCC2)/c(=N/C2CCCCC2)p(I)/c(=N\C2CCCCC2)n1C1CCCCC1 |
| InChI | InChI=1S/C27H44IN4OP/c28-34-25(29-21-13-5-1-6-14-21)31(23-17-9-3-10-18-23)27(33)32(24-19-11-4-12-20-24)26(34)30-22-15-7-2-8-16-22/h21-24H,1-20H2/b29-25-,30-26- |
| InChIKey | ZLQDVFNCHTYJML-IDDWGTJGSA-N |
| XLogP | 7.31 |
| TPSA | 51.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.55 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|