C14H20N2O2S — CID 46863389
2-cycloheptylimino-3-cyclopropyl-1,3-thiazole-4-carboxylic acid (PubChem CID 46863389) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 2-cycloheptylimino-3-cyclopropyl-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-cycloheptylimino-3-cyclopropyl-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 46863389 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-cycloheptylimino-3-cyclopropyl-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1cs/c(=N\C2CCCCCC2)n1C1CC1 |
| InChI | InChI=1S/C14H20N2O2S/c17-13(18)12-9-19-14(16(12)11-7-8-11)15-10-5-3-1-2-4-6-10/h9-11H,1-8H2,(H,17,18)/b15-14- |
| InChIKey | RMEPEKIZMNCBKA-PFONDFGASA-N |
| XLogP | 3.21 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |