C18H28N2O2S — CID 46863274
ethyl 2-(2-cycloheptylimino-3-cyclopropyl-5-methyl-1,3-thiazol-4-yl)acetate (PubChem CID 46863274) has the molecular formula C18H28N2O2S and a molecular weight of 336.50 g/mol. Its IUPAC name is ethyl 2-(2-cycloheptylimino-3-cyclopropyl-5-methyl-1,3-thiazol-4-yl)acetate.
| Compound Name | ethyl 2-(2-cycloheptylimino-3-cyclopropyl-5-methyl-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 46863274 |
| Molecular Formula | C18H28N2O2S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | ethyl 2-(2-cycloheptylimino-3-cyclopropyl-5-methyl-1,3-thiazol-4-yl)acetate |
| SMILES | CCOC(=O)Cc1c(C)s/c(=N\C2CCCCCC2)n1C1CC1 |
| InChI | InChI=1S/C18H28N2O2S/c1-3-22-17(21)12-16-13(2)23-18(20(16)15-10-11-15)19-14-8-6-4-5-7-9-14/h14-15H,3-12H2,1-2H3/b19-18- |
| InChIKey | CTZOVVFLJGCBTC-HNENSFHCSA-N |
| XLogP | 3.92 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|