C18H28N4O3S — CID 8629266
ethyl 2-[4-cyclohexyl-5-[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl]sulfanyl-1,2,4-triazol-3-yl]acetate (PubChem CID 8629266) has the molecular formula C18H28N4O3S and a molecular weight of 380.51 g/mol. Its IUPAC name is ethyl 2-[4-cyclohexyl-5-[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl]sulfanyl-1,2,4-triazol-3-yl]acetate.
| Compound Name | ethyl 2-[4-cyclohexyl-5-[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl]sulfanyl-1,2,4-triazol-3-yl]acetate |
|---|---|
| PubChem CID | 8629266 |
| Molecular Formula | C18H28N4O3S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | ethyl 2-[4-cyclohexyl-5-[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl]sulfanyl-1,2,4-triazol-3-yl]acetate |
| SMILES | C=CCNC(=O)[C@H](C)Sc1nnc(CC(=O)OCC)n1C1CCCCC1 |
| InChI | InChI=1S/C18H28N4O3S/c1-4-11-19-17(24)13(3)26-18-21-20-15(12-16(23)25-5-2)22(18)14-9-7-6-8-10-14/h4,13-14H,1,5-12H2,2-3H3,(H,19,24)/t13-/m0/s1 |
| InChIKey | ICKMEMGGOMCNGE-ZDUSSCGKSA-N |
| XLogP | 2.67 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|