C15H23N3O3S — CID 146026432
ethyl 2-cyclohexylimino-3-hydroxy-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-3-carboxylate (PubChem CID 146026432) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is ethyl 2-cyclohexylimino-3-hydroxy-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-3-carboxylate.
| Compound Name | ethyl 2-cyclohexylimino-3-hydroxy-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 146026432 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | ethyl 2-cyclohexylimino-3-hydroxy-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-3-carboxylate |
| SMILES | CCOC(=O)C1(O)/C(=N/C2CCCCC2)SC2=NCCCN21 |
| InChI | InChI=1S/C15H23N3O3S/c1-2-21-13(19)15(20)12(17-11-7-4-3-5-8-11)22-14-16-9-6-10-18(14)15/h11,20H,2-10H2,1H3/b17-12- |
| InChIKey | UFSSXEQPPQEUIM-ATVHPVEESA-N |
| XLogP | 1.78 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|