C19H26N4O — CID 16680667
3-cyclohexyl-2-cyclohexyliminopyrido[2,1-f][1,2,4]triazin-9-ium-4-olate (PubChem CID 16680667) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is 3-cyclohexyl-2-cyclohexyliminopyrido[2,1-f][1,2,4]triazin-9-ium-4-olate.
| Compound Name | 3-cyclohexyl-2-cyclohexyliminopyrido[2,1-f][1,2,4]triazin-9-ium-4-olate |
|---|---|
| PubChem CID | 16680667 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 3-cyclohexyl-2-cyclohexyliminopyrido[2,1-f][1,2,4]triazin-9-ium-4-olate |
| SMILES | [O-]c1c2cccc[n+]2n/c(=N\C2CCCCC2)n1C1CCCCC1 |
| InChI | InChI=1S/C19H26N4O/c24-18-17-13-7-8-14-22(17)21-19(20-15-9-3-1-4-10-15)23(18)16-11-5-2-6-12-16/h7-8,13-16H,1-6,9-12H2 |
| InChIKey | MWJJXJUBLDJRHT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 57.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|