C18H16F3NO2S — CID 134920767
methyl (Z)-3-anilino-3-benzylsulfanyl-2-(trifluoromethyl)prop-2-enoate (PubChem CID 134920767) has the molecular formula C18H16F3NO2S and a molecular weight of 367.39 g/mol. Its IUPAC name is methyl (Z)-3-anilino-3-benzylsulfanyl-2-(trifluoromethyl)prop-2-enoate.
| Compound Name | methyl (Z)-3-anilino-3-benzylsulfanyl-2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134920767 |
| Molecular Formula | C18H16F3NO2S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | methyl (Z)-3-anilino-3-benzylsulfanyl-2-(trifluoromethyl)prop-2-enoate |
| SMILES | COC(=O)/C(=C(\Nc1ccccc1)SCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H16F3NO2S/c1-24-17(23)15(18(19,20)21)16(22-14-10-6-3-7-11-14)25-12-13-8-4-2-5-9-13/h2-11,22H,12H2,1H3/b16-15- |
| InChIKey | AZDXCMHSULVCOU-NXVVXOECSA-N |
| XLogP | 4.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|