C20H20F3NO2S — CID 134920770
methyl (Z)-3-benzylsulfanyl-3-(4-ethylanilino)-2-(trifluoromethyl)prop-2-enoate (PubChem CID 134920770) has the molecular formula C20H20F3NO2S and a molecular weight of 395.45 g/mol. Its IUPAC name is methyl (Z)-3-benzylsulfanyl-3-(4-ethylanilino)-2-(trifluoromethyl)prop-2-enoate.
| Compound Name | methyl (Z)-3-benzylsulfanyl-3-(4-ethylanilino)-2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134920770 |
| Molecular Formula | C20H20F3NO2S |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | methyl (Z)-3-benzylsulfanyl-3-(4-ethylanilino)-2-(trifluoromethyl)prop-2-enoate |
| SMILES | CCc1ccc(N/C(SCc2ccccc2)=C(\C(=O)OC)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H20F3NO2S/c1-3-14-9-11-16(12-10-14)24-18(17(19(25)26-2)20(21,22)23)27-13-15-7-5-4-6-8-15/h4-12,24H,3,13H2,1-2H3/b18-17- |
| InChIKey | SGJOCKMBVBVWGH-ZCXUNETKSA-N |
| XLogP | 5.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|