C18H24F3NO2S — CID 5378272
ethyl (Z)-3-tert-butylsulfanyl-3-(4-ethylanilino)-2-(trifluoromethyl)prop-2-enoate (PubChem CID 5378272) has the molecular formula C18H24F3NO2S and a molecular weight of 375.46 g/mol. Its IUPAC name is ethyl (Z)-3-tert-butylsulfanyl-3-(4-ethylanilino)-2-(trifluoromethyl)prop-2-enoate.
| Compound Name | ethyl (Z)-3-tert-butylsulfanyl-3-(4-ethylanilino)-2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 5378272 |
| Molecular Formula | C18H24F3NO2S |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | ethyl (Z)-3-tert-butylsulfanyl-3-(4-ethylanilino)-2-(trifluoromethyl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C(\Nc1ccc(CC)cc1)SC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C18H24F3NO2S/c1-6-12-8-10-13(11-9-12)22-15(25-17(3,4)5)14(18(19,20)21)16(23)24-7-2/h8-11,22H,6-7H2,1-5H3/b15-14- |
| InChIKey | SLIVAQICKUFXLT-PFONDFGASA-N |
| XLogP | 5.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|