C17H17F3N2O4S — CID 3701516
ethyl 2-cyano-3-(2-ethoxy-2-oxoethyl)sulfanyl-3-[2-(trifluoromethyl)anilino]prop-2-enoate (PubChem CID 3701516) has the molecular formula C17H17F3N2O4S and a molecular weight of 402.39 g/mol. Its IUPAC name is ethyl 2-cyano-3-(2-ethoxy-2-oxoethyl)sulfanyl-3-[2-(trifluoromethyl)anilino]prop-2-enoate.
| Compound Name | ethyl 2-cyano-3-(2-ethoxy-2-oxoethyl)sulfanyl-3-[2-(trifluoromethyl)anilino]prop-2-enoate |
|---|---|
| PubChem CID | 3701516 |
| Molecular Formula | C17H17F3N2O4S |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | ethyl 2-cyano-3-(2-ethoxy-2-oxoethyl)sulfanyl-3-[2-(trifluoromethyl)anilino]prop-2-enoate |
| SMILES | CCOC(=O)CSC(Nc1ccccc1C(F)(F)F)=C(C#N)C(=O)OCC |
| InChI | InChI=1S/C17H17F3N2O4S/c1-3-25-14(23)10-27-15(11(9-21)16(24)26-4-2)22-13-8-6-5-7-12(13)17(18,19)20/h5-8,22H,3-4,10H2,1-2H3 |
| InChIKey | JKXBZCRFARDOEK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|