C8H12Cl2S — CID 134920794
(Z)-1-[(Z)-1,2-dichloroprop-1-enyl]sulfanyl-2-methylbut-2-ene (PubChem CID 134920794) has the molecular formula C8H12Cl2S and a molecular weight of 211.16 g/mol. Its IUPAC name is (Z)-1-[(Z)-1,2-dichloroprop-1-enyl]sulfanyl-2-methylbut-2-ene.
| Compound Name | (Z)-1-[(Z)-1,2-dichloroprop-1-enyl]sulfanyl-2-methylbut-2-ene |
|---|---|
| PubChem CID | 134920794 |
| Molecular Formula | C8H12Cl2S |
| Molecular Weight | 211.16 g/mol |
| Exact Mass | 210.00 |
| IUPAC Name | (Z)-1-[(Z)-1,2-dichloroprop-1-enyl]sulfanyl-2-methylbut-2-ene |
| SMILES | C/C=C(/C)CS/C(Cl)=C(\C)Cl |
| InChI | InChI=1S/C8H12Cl2S/c1-4-6(2)5-11-8(10)7(3)9/h4H,5H2,1-3H3/b6-4-,8-7+ |
| InChIKey | WWDNSSQNBXAHOG-IQTBQJLQSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.16 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|