C7H9Cl3S — CID 13066013
3-methyl-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene (PubChem CID 13066013) has the molecular formula C7H9Cl3S and a molecular weight of 231.57 g/mol. Its IUPAC name is 3-methyl-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene.
| Compound Name | 3-methyl-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene |
|---|---|
| PubChem CID | 13066013 |
| Molecular Formula | C7H9Cl3S |
| Molecular Weight | 231.57 g/mol |
| Exact Mass | 229.95 |
| IUPAC Name | 3-methyl-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene |
| SMILES | CC(C)=CCSC(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C7H9Cl3S/c1-5(2)3-4-11-7(10)6(8)9/h3H,4H2,1-2H3 |
| InChIKey | PDXILRNLAXTVPG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|