C5H7NO2 — CID 13492096
(4-methyl-1,2-oxazol-3-yl)methanol (PubChem CID 13492096) has the molecular formula C5H7NO2 and a molecular weight of 113.12 g/mol. Its IUPAC name is (4-methyl-1,2-oxazol-3-yl)methanol.
| Compound Name | (4-methyl-1,2-oxazol-3-yl)methanol |
|---|---|
| PubChem CID | 13492096 |
| Molecular Formula | C5H7NO2 |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.05 |
| IUPAC Name | (4-methyl-1,2-oxazol-3-yl)methanol |
| SMILES | Cc1conc1CO |
| InChI | InChI=1S/C5H7NO2/c1-4-3-8-6-5(4)2-7/h3,7H,2H2,1H3 |
| InChIKey | WNGBGXLNOIQJGE-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |