About 1,2-oxazol-3-ylmethanediol
1,2-oxazol-3-ylmethanediol (PubChem CID 66718249) has the molecular formula C4H5NO3
and a molecular weight of 115.09 g/mol. Its IUPAC name is 1,2-oxazol-3-ylmethanediol.
Molecular Properties
| Compound Name | 1,2-oxazol-3-ylmethanediol |
| PubChem CID | 66718249 |
| Molecular Formula | C4H5NO3 |
| Molecular Weight | 115.09 g/mol |
| Exact Mass | 115.03 |
| IUPAC Name | 1,2-oxazol-3-ylmethanediol |
| SMILES | OC(O)c1ccon1 |
| InChI | InChI=1S/C4H5NO3/c6-4(7)3-1-2-8-5-3/h1-2,4,6-7H |
| InChIKey | AJQWQZSJSRJRFI-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.09 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,2-oxazol-3-ylmethanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-oxazol-3-ylmethanediol?
The IUPAC name of 1,2-oxazol-3-ylmethanediol (CID 66718249) is 1,2-oxazol-3-ylmethanediol.
What is the SMILES notation for 1,2-oxazol-3-ylmethanediol?
The canonical SMILES for 1,2-oxazol-3-ylmethanediol is OC(O)c1ccon1.
What is the InChIKey of 1,2-oxazol-3-ylmethanediol?
The InChIKey is AJQWQZSJSRJRFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO3/c6-4(7)3-1-2-8-5-3/h1-2,4,6-7H.
What are the key properties of 1,2-oxazol-3-ylmethanediol?
1,2-oxazol-3-ylmethanediol has a molecular weight of 115.09 g/mol, XLogP of -0.34, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-oxazol-3-ylmethanediol is sourced from PubChem (CID 66718249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).