C16H18O5S — CID 134921224
(1R,4S)-8,8-dimethoxy-4-(4-methylphenyl)sulfinyl-2-oxabicyclo[2.2.2]oct-5-en-3-one (PubChem CID 134921224) has the molecular formula C16H18O5S and a molecular weight of 322.38 g/mol. Its IUPAC name is (1R,4S)-8,8-dimethoxy-4-(4-methylphenyl)sulfinyl-2-oxabicyclo[2.2.2]oct-5-en-3-one.
| Compound Name | (1R,4S)-8,8-dimethoxy-4-(4-methylphenyl)sulfinyl-2-oxabicyclo[2.2.2]oct-5-en-3-one |
|---|---|
| PubChem CID | 134921224 |
| Molecular Formula | C16H18O5S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | (1R,4S)-8,8-dimethoxy-4-(4-methylphenyl)sulfinyl-2-oxabicyclo[2.2.2]oct-5-en-3-one |
| SMILES | COC1(OC)C[C@@H]2C=C[C@@]1(S(=O)c1ccc(C)cc1)C(=O)O2 |
| InChI | InChI=1S/C16H18O5S/c1-11-4-6-13(7-5-11)22(18)15-9-8-12(21-14(15)17)10-16(15,19-2)20-3/h4-9,12H,10H2,1-3H3/t12-,15+,22?/m0/s1 |
| InChIKey | AWTMSMQLAMNAAS-JLBCRZEMSA-N |
| XLogP | 1.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|