C18H24O5S — CID 172546292
[(E)-4-(5-ethyl-6-oxooxan-2-yl)but-3-enyl] 4-methylbenzenesulfonate (PubChem CID 172546292) has the molecular formula C18H24O5S and a molecular weight of 352.45 g/mol. Its IUPAC name is [(E)-4-(5-ethyl-6-oxooxan-2-yl)but-3-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(E)-4-(5-ethyl-6-oxooxan-2-yl)but-3-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 172546292 |
| Molecular Formula | C18H24O5S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | [(E)-4-(5-ethyl-6-oxooxan-2-yl)but-3-enyl] 4-methylbenzenesulfonate |
| SMILES | CCC1CCC(/C=C/CCOS(=O)(=O)c2ccc(C)cc2)OC1=O |
| InChI | InChI=1S/C18H24O5S/c1-3-15-9-10-16(23-18(15)19)6-4-5-13-22-24(20,21)17-11-7-14(2)8-12-17/h4,6-8,11-12,15-16H,3,5,9-10,13H2,1-2H3/b6-4+ |
| InChIKey | VLQWWJFXDDCWIZ-GQCTYLIASA-N |
| XLogP | 3.38 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|