About 9-[(Z)-1,2-dichloroethenyl]-6-phenylmethoxypurine
9-[(Z)-1,2-dichloroethenyl]-6-phenylmethoxypurine (PubChem CID 134921449) has the molecular formula C14H10Cl2N4O
and a molecular weight of 321.17 g/mol. Its IUPAC name is 9-[(Z)-1,2-dichloroethenyl]-6-phenylmethoxypurine.
Molecular Properties
| Compound Name | 9-[(Z)-1,2-dichloroethenyl]-6-phenylmethoxypurine |
| PubChem CID | 134921449 |
| Molecular Formula | C14H10Cl2N4O |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 9-[(Z)-1,2-dichloroethenyl]-6-phenylmethoxypurine |
| SMILES | Cl/C=C(\Cl)n1cnc2c(OCc3ccccc3)ncnc21 |
| InChI | InChI=1S/C14H10Cl2N4O/c15-6-11(16)20-9-19-12-13(20)17-8-18-14(12)21-7-10-4-2-1-3-5-10/h1-6,8-9H,7H2/b11-6+ |
| InChIKey | ZHLHCYSUCZWRIY-IZZDOVSWSA-N |
| XLogP | 3.64 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-[(Z)-1,2-dichloroethenyl]-6-phenylmethoxypurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(Z)-1,2-dichloroethenyl]-6-phenylmethoxypurine?
The IUPAC name of 9-[(Z)-1,2-dichloroethenyl]-6-phenylmethoxypurine (CID 134921449) is 9-[(Z)-1,2-dichloroethenyl]-6-phenylmethoxypurine.
What is the SMILES notation for 9-[(Z)-1,2-dichloroethenyl]-6-phenylmethoxypurine?
The canonical SMILES for 9-[(Z)-1,2-dichloroethenyl]-6-phenylmethoxypurine is Cl/C=C(\Cl)n1cnc2c(OCc3ccccc3)ncnc21.
What is the InChIKey of 9-[(Z)-1,2-dichloroethenyl]-6-phenylmethoxypurine?
The InChIKey is ZHLHCYSUCZWRIY-IZZDOVSWSA-N. The full InChI is InChI=1S/C14H10Cl2N4O/c15-6-11(16)20-9-19-12-13(20)17-8-18-14(12)21-7-10-4-2-1-3-5-10/h1-6,8-9H,7H2/b11-6+.
What are the key properties of 9-[(Z)-1,2-dichloroethenyl]-6-phenylmethoxypurine?
9-[(Z)-1,2-dichloroethenyl]-6-phenylmethoxypurine has a molecular weight of 321.17 g/mol, XLogP of 3.64, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(Z)-1,2-dichloroethenyl]-6-phenylmethoxypurine is sourced from PubChem (CID 134921449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).