C15H18Cl2N2O2 — CID 134921836
(E)-4,4-dichloro-N-(4-methylphenyl)-3-morpholin-4-ylbut-2-enamide (PubChem CID 134921836) has the molecular formula C15H18Cl2N2O2 and a molecular weight of 329.23 g/mol. Its IUPAC name is (E)-4,4-dichloro-N-(4-methylphenyl)-3-morpholin-4-ylbut-2-enamide.
| Compound Name | (E)-4,4-dichloro-N-(4-methylphenyl)-3-morpholin-4-ylbut-2-enamide |
|---|---|
| PubChem CID | 134921836 |
| Molecular Formula | C15H18Cl2N2O2 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | (E)-4,4-dichloro-N-(4-methylphenyl)-3-morpholin-4-ylbut-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C=C(\C(Cl)Cl)N2CCOCC2)cc1 |
| InChI | InChI=1S/C15H18Cl2N2O2/c1-11-2-4-12(5-3-11)18-14(20)10-13(15(16)17)19-6-8-21-9-7-19/h2-5,10,15H,6-9H2,1H3,(H,18,20)/b13-10+ |
| InChIKey | KCZNBWFDLCBRDI-JLHYYAGUSA-N |
| XLogP | 2.95 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|