C16H18N4O3 — CID 5348323
N-(4-methylphenyl)-3-(morpholine-4-carbonyl)pyrazole-1-carboxamide (PubChem CID 5348323) has the molecular formula C16H18N4O3 and a molecular weight of 314.34 g/mol. Its IUPAC name is N-(4-methylphenyl)-3-(morpholine-4-carbonyl)pyrazole-1-carboxamide.
| Compound Name | N-(4-methylphenyl)-3-(morpholine-4-carbonyl)pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 5348323 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N-(4-methylphenyl)-3-(morpholine-4-carbonyl)pyrazole-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)n2ccc(C(=O)N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C16H18N4O3/c1-12-2-4-13(5-3-12)17-16(22)20-7-6-14(18-20)15(21)19-8-10-23-11-9-19/h2-7H,8-11H2,1H3,(H,17,22) |
| InChIKey | NFOGYGGXXJKOKH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |