C14H20O3 — CID 134922517
methyl (3aR,7aR)-7a-ethyl-1-methyl-6-oxo-3,4,5,7-tetrahydroindene-3a-carboxylate (PubChem CID 134922517) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is methyl (3aR,7aR)-7a-ethyl-1-methyl-6-oxo-3,4,5,7-tetrahydroindene-3a-carboxylate.
| Compound Name | methyl (3aR,7aR)-7a-ethyl-1-methyl-6-oxo-3,4,5,7-tetrahydroindene-3a-carboxylate |
|---|---|
| PubChem CID | 134922517 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | methyl (3aR,7aR)-7a-ethyl-1-methyl-6-oxo-3,4,5,7-tetrahydroindene-3a-carboxylate |
| SMILES | CC[C@]12CC(=O)CC[C@@]1(C(=O)OC)CC=C2C |
| InChI | InChI=1S/C14H20O3/c1-4-13-9-11(15)6-8-14(13,12(16)17-3)7-5-10(13)2/h5H,4,6-9H2,1-3H3/t13-,14-/m1/s1 |
| InChIKey | AZDGBKFAAQMLRT-ZIAGYGMSSA-N |
| XLogP | 2.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|