C14H21FO2 — CID 144643280
fluoro (3R)-3-(7a-methyl-3,3a,4,5,6,7-hexahydroinden-1-yl)butanoate (PubChem CID 144643280) has the molecular formula C14H21FO2 and a molecular weight of 240.32 g/mol. Its IUPAC name is fluoro (3R)-3-(7a-methyl-3,3a,4,5,6,7-hexahydroinden-1-yl)butanoate.
| Compound Name | fluoro (3R)-3-(7a-methyl-3,3a,4,5,6,7-hexahydroinden-1-yl)butanoate |
|---|---|
| PubChem CID | 144643280 |
| Molecular Formula | C14H21FO2 |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | fluoro (3R)-3-(7a-methyl-3,3a,4,5,6,7-hexahydroinden-1-yl)butanoate |
| SMILES | C[C@H](CC(=O)OF)C1=CCC2CCCCC12C |
| InChI | InChI=1S/C14H21FO2/c1-10(9-13(16)17-15)12-7-6-11-5-3-4-8-14(11,12)2/h7,10-11H,3-6,8-9H2,1-2H3/t10-,11?,14?/m1/s1 |
| InChIKey | FDAIWVYVOICEAD-CDWSIMAYSA-N |
| XLogP | 3.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|