C11H21NO — CID 134922741
(2R,3S)-N,N-diethyl-2,3-dimethylpent-4-enamide (PubChem CID 134922741) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (2R,3S)-N,N-diethyl-2,3-dimethylpent-4-enamide.
| Compound Name | (2R,3S)-N,N-diethyl-2,3-dimethylpent-4-enamide |
|---|---|
| PubChem CID | 134922741 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (2R,3S)-N,N-diethyl-2,3-dimethylpent-4-enamide |
| SMILES | C=C[C@H](C)[C@@H](C)C(=O)N(CC)CC |
| InChI | InChI=1S/C11H21NO/c1-6-9(4)10(5)11(13)12(7-2)8-3/h6,9-10H,1,7-8H2,2-5H3/t9-,10+/m0/s1 |
| InChIKey | KFLJSNLOBLSWKE-VHSXEESVSA-N |
| XLogP | 2.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|