C13H20O5 — CID 134922948
methyl (E)-3-[(2R,3S)-2-(3-oxopropyl)oxan-3-yl]oxybut-2-enoate (PubChem CID 134922948) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is methyl (E)-3-[(2R,3S)-2-(3-oxopropyl)oxan-3-yl]oxybut-2-enoate.
| Compound Name | methyl (E)-3-[(2R,3S)-2-(3-oxopropyl)oxan-3-yl]oxybut-2-enoate |
|---|---|
| PubChem CID | 134922948 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | methyl (E)-3-[(2R,3S)-2-(3-oxopropyl)oxan-3-yl]oxybut-2-enoate |
| SMILES | COC(=O)/C=C(\C)O[C@H]1CCCO[C@@H]1CCC=O |
| InChI | InChI=1S/C13H20O5/c1-10(9-13(15)16-2)18-12-6-4-8-17-11(12)5-3-7-14/h7,9,11-12H,3-6,8H2,1-2H3/b10-9+/t11-,12+/m1/s1 |
| InChIKey | YUIZSABHMHZMNF-ZGFRAZBVSA-N |
| XLogP | 1.61 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|