C10H18N2O — CID 134923795
5-(diethylamino)-2,4-dimethyl-1,2-dihydropyrrol-3-one (PubChem CID 134923795) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 5-(diethylamino)-2,4-dimethyl-1,2-dihydropyrrol-3-one.
| Compound Name | 5-(diethylamino)-2,4-dimethyl-1,2-dihydropyrrol-3-one |
|---|---|
| PubChem CID | 134923795 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 5-(diethylamino)-2,4-dimethyl-1,2-dihydropyrrol-3-one |
| SMILES | CCN(CC)C1=C(C)C(=O)C(C)N1 |
| InChI | InChI=1S/C10H18N2O/c1-5-12(6-2)10-7(3)9(13)8(4)11-10/h8,11H,5-6H2,1-4H3 |
| InChIKey | QPATZBJSVNBEDT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |