C11H17N3O2S — CID 134924000
4-amino-2,6-dioxo-1,3-dipropylpyrimidine-5-carbothialdehyde (PubChem CID 134924000) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 4-amino-2,6-dioxo-1,3-dipropylpyrimidine-5-carbothialdehyde.
| Compound Name | 4-amino-2,6-dioxo-1,3-dipropylpyrimidine-5-carbothialdehyde |
|---|---|
| PubChem CID | 134924000 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 4-amino-2,6-dioxo-1,3-dipropylpyrimidine-5-carbothialdehyde |
| SMILES | CCCn1c(N)c(C=S)c(=O)n(CCC)c1=O |
| InChI | InChI=1S/C11H17N3O2S/c1-3-5-13-9(12)8(7-17)10(15)14(6-4-2)11(13)16/h7H,3-6,12H2,1-2H3 |
| InChIKey | YFZXGSJUGZPPHO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|