C13H22N4O2S — CID 11738085
4-amino-1,3-dibutyl-2,6-dioxopyrimidine-5-carbothioamide (PubChem CID 11738085) has the molecular formula C13H22N4O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is 4-amino-1,3-dibutyl-2,6-dioxopyrimidine-5-carbothioamide.
| Compound Name | 4-amino-1,3-dibutyl-2,6-dioxopyrimidine-5-carbothioamide |
|---|---|
| PubChem CID | 11738085 |
| Molecular Formula | C13H22N4O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 4-amino-1,3-dibutyl-2,6-dioxopyrimidine-5-carbothioamide |
| SMILES | CCCCn1c(N)c(C(N)=S)c(=O)n(CCCC)c1=O |
| InChI | InChI=1S/C13H22N4O2S/c1-3-5-7-16-10(14)9(11(15)20)12(18)17(13(16)19)8-6-4-2/h3-8,14H2,1-2H3,(H2,15,20) |
| InChIKey | NRIIVPYJXSXAAV-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|