C15H18N4O3 — CID 10266899
5,6-diamino-3-benzoyl-1-butylpyrimidine-2,4-dione (PubChem CID 10266899) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 5,6-diamino-3-benzoyl-1-butylpyrimidine-2,4-dione.
| Compound Name | 5,6-diamino-3-benzoyl-1-butylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10266899 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 5,6-diamino-3-benzoyl-1-butylpyrimidine-2,4-dione |
| SMILES | CCCCn1c(N)c(N)c(=O)n(C(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C15H18N4O3/c1-2-3-9-18-12(17)11(16)14(21)19(15(18)22)13(20)10-7-5-4-6-8-10/h4-8H,2-3,9,16-17H2,1H3 |
| InChIKey | PTVSUNQAOLOVTQ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |