C20H24FN3O4 — CID 72550231
3-benzoyl-5-fluoro-N-octyl-2,4-dioxopyrimidine-1-carboxamide (PubChem CID 72550231) has the molecular formula C20H24FN3O4 and a molecular weight of 389.43 g/mol. Its IUPAC name is 3-benzoyl-5-fluoro-N-octyl-2,4-dioxopyrimidine-1-carboxamide.
| Compound Name | 3-benzoyl-5-fluoro-N-octyl-2,4-dioxopyrimidine-1-carboxamide |
|---|---|
| PubChem CID | 72550231 |
| Molecular Formula | C20H24FN3O4 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 3-benzoyl-5-fluoro-N-octyl-2,4-dioxopyrimidine-1-carboxamide |
| SMILES | CCCCCCCCNC(=O)n1cc(F)c(=O)n(C(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C20H24FN3O4/c1-2-3-4-5-6-10-13-22-19(27)23-14-16(21)18(26)24(20(23)28)17(25)15-11-8-7-9-12-15/h7-9,11-12,14H,2-6,10,13H2,1H3,(H,22,27) |
| InChIKey | FNYHSEXUQWDVCS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|