C19H29FN4O5 — CID 58492764
methyl 8-[[5-fluoro-2-oxo-1-(pentylcarbamoyl)pyrimidin-4-yl]amino]-8-oxooctanoate (PubChem CID 58492764) has the molecular formula C19H29FN4O5 and a molecular weight of 412.46 g/mol. Its IUPAC name is methyl 8-[[5-fluoro-2-oxo-1-(pentylcarbamoyl)pyrimidin-4-yl]amino]-8-oxooctanoate.
| Compound Name | methyl 8-[[5-fluoro-2-oxo-1-(pentylcarbamoyl)pyrimidin-4-yl]amino]-8-oxooctanoate |
|---|---|
| PubChem CID | 58492764 |
| Molecular Formula | C19H29FN4O5 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | methyl 8-[[5-fluoro-2-oxo-1-(pentylcarbamoyl)pyrimidin-4-yl]amino]-8-oxooctanoate |
| SMILES | CCCCCNC(=O)n1cc(F)c(NC(=O)CCCCCCC(=O)OC)nc1=O |
| InChI | InChI=1S/C19H29FN4O5/c1-3-4-9-12-21-18(27)24-13-14(20)17(23-19(24)28)22-15(25)10-7-5-6-8-11-16(26)29-2/h13H,3-12H2,1-2H3,(H,21,27)(H,22,23,25,28) |
| InChIKey | UOISFXBHHXCXJM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|