C14H20FN3O4 — CID 139518888
methyl 9-[(5-fluoro-2-oxo-1H-pyrimidin-6-yl)amino]-9-oxononanoate (PubChem CID 139518888) has the molecular formula C14H20FN3O4 and a molecular weight of 313.33 g/mol. Its IUPAC name is methyl 9-[(5-fluoro-2-oxo-1H-pyrimidin-6-yl)amino]-9-oxononanoate.
| Compound Name | methyl 9-[(5-fluoro-2-oxo-1H-pyrimidin-6-yl)amino]-9-oxononanoate |
|---|---|
| PubChem CID | 139518888 |
| Molecular Formula | C14H20FN3O4 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | methyl 9-[(5-fluoro-2-oxo-1H-pyrimidin-6-yl)amino]-9-oxononanoate |
| SMILES | COC(=O)CCCCCCCC(=O)Nc1[nH]c(=O)ncc1F |
| InChI | InChI=1S/C14H20FN3O4/c1-22-12(20)8-6-4-2-3-5-7-11(19)17-13-10(15)9-16-14(21)18-13/h9H,2-8H2,1H3,(H2,16,17,18,19,21) |
| InChIKey | JSQVDKZXOPTURR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|