C18H28FN5O6 — CID 58492769
pentyl N-[5-fluoro-1-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-2-oxopyrimidin-4-yl]carbamate (PubChem CID 58492769) has the molecular formula C18H28FN5O6 and a molecular weight of 429.45 g/mol. Its IUPAC name is pentyl N-[5-fluoro-1-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | pentyl N-[5-fluoro-1-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 58492769 |
| Molecular Formula | C18H28FN5O6 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | pentyl N-[5-fluoro-1-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-2-oxopyrimidin-4-yl]carbamate |
| SMILES | CCCCCOC(=O)Nc1nc(=O)n(C(=O)NCCCCCCC(=O)NO)cc1F |
| InChI | InChI=1S/C18H28FN5O6/c1-2-3-8-11-30-18(28)22-15-13(19)12-24(17(27)21-15)16(26)20-10-7-5-4-6-9-14(25)23-29/h12,29H,2-11H2,1H3,(H,20,26)(H,23,25)(H,21,22,27,28) |
| InChIKey | HPRZXTAXZNXARA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 151.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|