C19H26N4O3 — CID 71654887
5-[benzyl(methyl)amino]-N-hexyl-2,4-dioxopyrimidine-1-carboxamide (PubChem CID 71654887) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is 5-[benzyl(methyl)amino]-N-hexyl-2,4-dioxopyrimidine-1-carboxamide.
| Compound Name | 5-[benzyl(methyl)amino]-N-hexyl-2,4-dioxopyrimidine-1-carboxamide |
|---|---|
| PubChem CID | 71654887 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 5-[benzyl(methyl)amino]-N-hexyl-2,4-dioxopyrimidine-1-carboxamide |
| SMILES | CCCCCCNC(=O)n1cc(N(C)Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H26N4O3/c1-3-4-5-9-12-20-18(25)23-14-16(17(24)21-19(23)26)22(2)13-15-10-7-6-8-11-15/h6-8,10-11,14H,3-5,9,12-13H2,1-2H3,(H,20,25)(H,21,24,26) |
| InChIKey | BEKIUIYGGADQSJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|