C13H19N3O5 — CID 162654698
[1-(hexylcarbamoyl)-2,4-dioxopyrimidin-5-yl] acetate (PubChem CID 162654698) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is [1-(hexylcarbamoyl)-2,4-dioxopyrimidin-5-yl] acetate.
| Compound Name | [1-(hexylcarbamoyl)-2,4-dioxopyrimidin-5-yl] acetate |
|---|---|
| PubChem CID | 162654698 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | [1-(hexylcarbamoyl)-2,4-dioxopyrimidin-5-yl] acetate |
| SMILES | CCCCCCNC(=O)n1cc(OC(C)=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H19N3O5/c1-3-4-5-6-7-14-12(19)16-8-10(21-9(2)17)11(18)15-13(16)20/h8H,3-7H2,1-2H3,(H,14,19)(H,15,18,20) |
| InChIKey | VQLOTZYIDCPZLI-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|