C20H25N3O5 — CID 162666025
[2,4-dioxo-1-(7-phenylheptylcarbamoyl)pyrimidin-5-yl] acetate (PubChem CID 162666025) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is [2,4-dioxo-1-(7-phenylheptylcarbamoyl)pyrimidin-5-yl] acetate.
| Compound Name | [2,4-dioxo-1-(7-phenylheptylcarbamoyl)pyrimidin-5-yl] acetate |
|---|---|
| PubChem CID | 162666025 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | [2,4-dioxo-1-(7-phenylheptylcarbamoyl)pyrimidin-5-yl] acetate |
| SMILES | CC(=O)Oc1cn(C(=O)NCCCCCCCc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H25N3O5/c1-15(24)28-17-14-23(20(27)22-18(17)25)19(26)21-13-9-4-2-3-6-10-16-11-7-5-8-12-16/h5,7-8,11-12,14H,2-4,6,9-10,13H2,1H3,(H,21,26)(H,22,25,27) |
| InChIKey | LXPTUXPDIPUELG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|