C15H19N4O5S- — CID 18449527
[4-[2-(5,6-diamino-2,4-dioxo-3-propylpyrimidin-1-yl)ethyl]phenyl] sulfite (PubChem CID 18449527) has the molecular formula C15H19N4O5S- and a molecular weight of 367.41 g/mol. Its IUPAC name is [4-[2-(5,6-diamino-2,4-dioxo-3-propylpyrimidin-1-yl)ethyl]phenyl] sulfite.
| Compound Name | [4-[2-(5,6-diamino-2,4-dioxo-3-propylpyrimidin-1-yl)ethyl]phenyl] sulfite |
|---|---|
| PubChem CID | 18449527 |
| Molecular Formula | C15H19N4O5S- |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | [4-[2-(5,6-diamino-2,4-dioxo-3-propylpyrimidin-1-yl)ethyl]phenyl] sulfite |
| SMILES | CCCn1c(=O)c(N)c(N)n(CCc2ccc(OS(=O)[O-])cc2)c1=O |
| InChI | InChI=1S/C15H20N4O5S/c1-2-8-19-14(20)12(16)13(17)18(15(19)21)9-7-10-3-5-11(6-4-10)24-25(22)23/h3-6H,2,7-9,16-17H2,1H3,(H,22,23)/p-1 |
| InChIKey | LRQSFCTXVIJMQO-UHFFFAOYSA-M |
| XLogP | -0.00 |
| TPSA | 145.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|