C17H25NO3 — CID 134924651
(3aS,4R,6R,6aR)-5-benzyl-4-ethyl-2,2,6-trimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium (PubChem CID 134924651) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is (3aS,4R,6R,6aR)-5-benzyl-4-ethyl-2,2,6-trimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium.
| Compound Name | (3aS,4R,6R,6aR)-5-benzyl-4-ethyl-2,2,6-trimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium |
|---|---|
| PubChem CID | 134924651 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (3aS,4R,6R,6aR)-5-benzyl-4-ethyl-2,2,6-trimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium |
| SMILES | CC[C@@H]1[C@@H]2OC(C)(C)O[C@@H]2[C@@H](C)[N+]1([O-])Cc1ccccc1 |
| InChI | InChI=1S/C17H25NO3/c1-5-14-16-15(20-17(3,4)21-16)12(2)18(14,19)11-13-9-7-6-8-10-13/h6-10,12,14-16H,5,11H2,1-4H3/t12-,14-,15-,16+,18?/m1/s1 |
| InChIKey | LUKWIIJLHWRDHE-VJUHNWGCSA-N |
| XLogP | 3.20 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|