C28H34N2O9 — CID 134925200
2-benzyl-5-(4-methoxyphenyl)-4-nitro-3-[(1S,2R,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1,2-oxazolidine (PubChem CID 134925200) has the molecular formula C28H34N2O9 and a molecular weight of 542.59 g/mol. Its IUPAC name is 2-benzyl-5-(4-methoxyphenyl)-4-nitro-3-[(1S,2R,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1,2-oxazolidine.
| Compound Name | 2-benzyl-5-(4-methoxyphenyl)-4-nitro-3-[(1S,2R,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1,2-oxazolidine |
|---|---|
| PubChem CID | 134925200 |
| Molecular Formula | C28H34N2O9 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | 2-benzyl-5-(4-methoxyphenyl)-4-nitro-3-[(1S,2R,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1,2-oxazolidine |
| SMILES | COc1ccc(C2ON(Cc3ccccc3)C(C3O[C@@H]4OC(C)(C)O[C@@H]4[C@H]4OC(C)(C)O[C@@H]34)C2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H34N2O9/c1-27(2)35-23-22(34-26-25(24(23)36-27)37-28(3,4)38-26)19-20(30(31)32)21(17-11-13-18(33-5)14-12-17)39-29(19)15-16-9-7-6-8-10-16/h6-14,19-26H,15H2,1-5H3/t19?,20?,21?,22?,23-,24-,25+,26+/m0/s1 |
| InChIKey | DOUHBFZTROEPOH-VRWXUDPUSA-N |
| XLogP | 3.59 |
| TPSA | 110.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|