C31H34N2O8 — CID 134925202
3-[(3aR,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-benzyl-5-(4-methoxyphenyl)-4-nitro-1,2-oxazolidine (PubChem CID 134925202) has the molecular formula C31H34N2O8 and a molecular weight of 562.62 g/mol. Its IUPAC name is 3-[(3aR,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-benzyl-5-(4-methoxyphenyl)-4-nitro-1,2-oxazolidine.
| Compound Name | 3-[(3aR,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-benzyl-5-(4-methoxyphenyl)-4-nitro-1,2-oxazolidine |
|---|---|
| PubChem CID | 134925202 |
| Molecular Formula | C31H34N2O8 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | 3-[(3aR,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-benzyl-5-(4-methoxyphenyl)-4-nitro-1,2-oxazolidine |
| SMILES | COc1ccc(C2ON(Cc3ccccc3)C(C3O[C@@H]4OC(C)(C)O[C@@H]4[C@@H]3OCc3ccccc3)C2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H34N2O8/c1-31(2)39-29-28(37-19-21-12-8-5-9-13-21)27(38-30(29)40-31)24-25(33(34)35)26(22-14-16-23(36-3)17-15-22)41-32(24)18-20-10-6-4-7-11-20/h4-17,24-30H,18-19H2,1-3H3/t24?,25?,26?,27?,28-,29-,30-/m1/s1 |
| InChIKey | KXPKSTYRHFADHO-SCIGQSAASA-N |
| XLogP | 4.66 |
| TPSA | 101.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|