C14H22N2 — CID 134925876
(2R,3R)-2,3-bis[(1E)-penta-1,4-dienyl]piperazine (PubChem CID 134925876) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is (2R,3R)-2,3-bis[(1E)-penta-1,4-dienyl]piperazine.
| Compound Name | (2R,3R)-2,3-bis[(1E)-penta-1,4-dienyl]piperazine |
|---|---|
| PubChem CID | 134925876 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | (2R,3R)-2,3-bis[(1E)-penta-1,4-dienyl]piperazine |
| SMILES | C=CC/C=C/[C@H]1NCCN[C@@H]1/C=C/CC=C |
| InChI | InChI=1S/C14H22N2/c1-3-5-7-9-13-14(10-8-6-4-2)16-12-11-15-13/h3-4,7-10,13-16H,1-2,5-6,11-12H2/b9-7+,10-8+/t13-,14-/m1/s1 |
| InChIKey | VGCCQBHRYKEIIV-JPSXRDQDSA-N |
| XLogP | 2.18 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|