C18H27NO — CID 134925894
N-(1-phenylbutoxy)-N-prop-2-enylpent-4-en-2-amine (PubChem CID 134925894) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is N-(1-phenylbutoxy)-N-prop-2-enylpent-4-en-2-amine.
| Compound Name | N-(1-phenylbutoxy)-N-prop-2-enylpent-4-en-2-amine |
|---|---|
| PubChem CID | 134925894 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | N-(1-phenylbutoxy)-N-prop-2-enylpent-4-en-2-amine |
| SMILES | C=CCC(C)N(CC=C)OC(CCC)c1ccccc1 |
| InChI | InChI=1S/C18H27NO/c1-5-11-16(4)19(15-7-3)20-18(12-6-2)17-13-9-8-10-14-17/h5,7-10,13-14,16,18H,1,3,6,11-12,15H2,2,4H3 |
| InChIKey | JHSYPCKGOMMLGN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|