C25H33NO — CID 134926351
(E)-4-methyl-1-phenyl-N-(1-phenylbutoxy)-N-prop-2-enylpent-1-en-2-amine (PubChem CID 134926351) has the molecular formula C25H33NO and a molecular weight of 363.55 g/mol. Its IUPAC name is (E)-4-methyl-1-phenyl-N-(1-phenylbutoxy)-N-prop-2-enylpent-1-en-2-amine.
| Compound Name | (E)-4-methyl-1-phenyl-N-(1-phenylbutoxy)-N-prop-2-enylpent-1-en-2-amine |
|---|---|
| PubChem CID | 134926351 |
| Molecular Formula | C25H33NO |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | (E)-4-methyl-1-phenyl-N-(1-phenylbutoxy)-N-prop-2-enylpent-1-en-2-amine |
| SMILES | C=CCN(OC(CCC)c1ccccc1)/C(=C/c1ccccc1)CC(C)C |
| InChI | InChI=1S/C25H33NO/c1-5-13-25(23-16-11-8-12-17-23)27-26(18-6-2)24(19-21(3)4)20-22-14-9-7-10-15-22/h6-12,14-17,20-21,25H,2,5,13,18-19H2,1,3-4H3/b24-20+ |
| InChIKey | LBGAKBHEABBIBT-HIXSDJFHSA-N |
| XLogP | 7.03 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|