C16H22NO+ — CID 134856200
(2R,3R,5S)-2-but-3-enyl-3-ethenyl-2-methyl-5-phenyl-1,2-oxazolidin-2-ium (PubChem CID 134856200) has the molecular formula C16H22NO+ and a molecular weight of 244.36 g/mol. Its IUPAC name is (2R,3R,5S)-2-but-3-enyl-3-ethenyl-2-methyl-5-phenyl-1,2-oxazolidin-2-ium.
| Compound Name | (2R,3R,5S)-2-but-3-enyl-3-ethenyl-2-methyl-5-phenyl-1,2-oxazolidin-2-ium |
|---|---|
| PubChem CID | 134856200 |
| Molecular Formula | C16H22NO+ |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | (2R,3R,5S)-2-but-3-enyl-3-ethenyl-2-methyl-5-phenyl-1,2-oxazolidin-2-ium |
| SMILES | C=CCC[N@@+]1(C)O[C@H](c2ccccc2)C[C@@H]1C=C |
| InChI | InChI=1S/C16H22NO/c1-4-6-12-17(3)15(5-2)13-16(18-17)14-10-8-7-9-11-14/h4-5,7-11,15-16H,1-2,6,12-13H2,3H3/q+1/t15-,16-,17+/m0/s1 |
| InChIKey | FBYFNYIWFOYJIK-YESZJQIVSA-N |
| XLogP | 3.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|